CAS 917925-71-4 appears in our catalog under these names: (4–Bromophenyl)((tert–butoxycarbonyl)amino)acetic acid, Boc-DL-Phg(4-Br)-OH 97%, (4-Bromophenyl)[(tert-butoxycarbonyl)amino]acetic acid, 98%, 2-(4-Bromophenyl)-2-((tert-butoxycarbonyl)amino)acetic acid, 97%, 2-(4-bromophenyl)-2-{((tert-butoxy)carbonyl)amino}acetic acid. Offered by: GLPBio, Ambeed, Combi-blocks, Biosynth, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g.
2-(4-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 917925-71-4) is a chemical compound with the molecular formula C13H16BrNO4 and a molecular weight of 330.17 g/mol. IUPAC name: 2-(4-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: HFPMULXPVQWEJG-UHFFFAOYSA-N.
| Molecular formula | C13H16BrNO4 |
|---|---|
| Molecular weight | 330.17 g/mol |
| IUPAC name | 2-(4-bromophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | HFPMULXPVQWEJG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1=CC=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)