CAS 2101207-01-4 is the registry number for 2-(4-Bromophenyl)piperidine hemioxalate, 98%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
2-(4-bromophenyl)piperidine;oxalic acid (CAS 2101207-01-4) is a chemical compound with the molecular formula C13H16BrNO4 and a molecular weight of 330.17 g/mol. IUPAC name: 2-(4-bromophenyl)piperidine;oxalic acid. InChIKey: MWRPPBMSGKZRBD-UHFFFAOYSA-N.
| Molecular formula | C13H16BrNO4 |
|---|---|
| Molecular weight | 330.17 g/mol |
| IUPAC name | 2-(4-bromophenyl)piperidine;oxalic acid |
| InChIKey | MWRPPBMSGKZRBD-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)C2=CC=C(C=C2)Br.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)