CAS 111769-27-8 appears in our catalog under these names: (R)-(+)-3-Aminotetrahydrofuran p-toluenesulfonate salt, 95%, (R)-Tetrahydrofuran-3-amine 4-methylbenzenesulfonate, 97%, 97%, (R)-Tetrahydrofuran-3-amine 4-methylbenzenesulfonate, 98%. Offered by: Thermo Scientific (Acros), Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 10g, 25g.
4-methylbenzenesulfonic acid;(3R)-oxolan-3-amine (CAS 111769-27-8) is a chemical compound with the molecular formula C11H17NO4S and a molecular weight of 259.32 g/mol. IUPAC name: 4-methylbenzenesulfonic acid;(3R)-oxolan-3-amine. InChIKey: BZXPLADBSZWDIH-FZSMXKCYSA-N.
| Molecular formula | C11H17NO4S |
|---|---|
| Molecular weight | 259.32 g/mol |
| IUPAC name | 4-methylbenzenesulfonic acid;(3R)-oxolan-3-amine |
| InChIKey | BZXPLADBSZWDIH-FZSMXKCYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1COC[C@@H]1N |
Computed by PubChem (NCBI)