CAS 1117893-19-2 is the registry number for dNAM. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 50mg, 100mg.
(2R,3S,5R)-2-(hydroxymethyl)-5-(3-methoxynaphthalen-2-yl)oxolan-3-ol (CAS 1117893-19-2) is a chemical compound with the molecular formula C16H18O4 and a molecular weight of 274.31 g/mol. IUPAC name: (2R,3S,5R)-2-(hydroxymethyl)-5-(3-methoxynaphthalen-2-yl)oxolan-3-ol. InChIKey: XVSHFDVHYNHNDU-NUEKZKHPSA-N.
| Molecular formula | C16H18O4 |
|---|---|
| Molecular weight | 274.31 g/mol |
| IUPAC name | (2R,3S,5R)-2-(hydroxymethyl)-5-(3-methoxynaphthalen-2-yl)oxolan-3-ol |
| InChIKey | XVSHFDVHYNHNDU-NUEKZKHPSA-N |
| SMILES | COC1=CC2=CC=CC=C2C=C1[C@H]3C[C@@H]([C@H](O3)CO)O |
Computed by PubChem (NCBI)