CAS 111955-03-4 is the registry number for (S)-Benzyl (1-oxopropan-2-yl)carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
Benzyl N-[(2S)-1-oxopropan-2-yl]carbamate (CAS 111955-03-4) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: benzyl N-[(2S)-1-oxopropan-2-yl]carbamate. InChIKey: XTXJPZGMVKIPHE-VIFPVBQESA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | benzyl N-[(2S)-1-oxopropan-2-yl]carbamate |
| InChIKey | XTXJPZGMVKIPHE-VIFPVBQESA-N |
| SMILES | C[C@@H](C=O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)