Products 111955-03-4

CAS 111955-03-4 is the registry number for (S)-Benzyl (1-oxopropan-2-yl)carbamate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.

Structural formula: {0} (CAS {1})

Benzyl N-[(2S)-1-oxopropan-2-yl]carbamate (CAS 111955-03-4) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: benzyl N-[(2S)-1-oxopropan-2-yl]carbamate. InChIKey: XTXJPZGMVKIPHE-VIFPVBQESA-N.

Identity
Molecular formulaC11H13NO3
Molecular weight207.23 g/mol
IUPAC namebenzyl N-[(2S)-1-oxopropan-2-yl]carbamate
InChIKeyXTXJPZGMVKIPHE-VIFPVBQESA-N
SMILESC[C@@H](C=O)NC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)