Products 112243-89-7

CAS 112243-89-7 is the registry number for N-Succinyl-D-alanine. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

4-[[(1R)-1-carboxyethyl]amino]-4-oxobutanoic acid (CAS 112243-89-7) is a chemical compound with the molecular formula C7H11NO5 and a molecular weight of 189.17 g/mol. IUPAC name: 4-[[(1R)-1-carboxyethyl]amino]-4-oxobutanoic acid. InChIKey: KAOMVEQNJVSESC-SCSAIBSYSA-N.

Identity
Molecular formulaC7H11NO5
Molecular weight189.17 g/mol
IUPAC name4-[[(1R)-1-carboxyethyl]amino]-4-oxobutanoic acid
InChIKeyKAOMVEQNJVSESC-SCSAIBSYSA-N
SMILESC[C@H](C(=O)O)NC(=O)CCC(=O)O

Computed by PubChem (NCBI)

Synonyms: orb3180477