Products 119673-94-8
CAS 119673-94-8 appears in our catalog under these names: 4-Nitropyridine-d4 N-Oxide, 99 atom % D, min 98% Chemical Purity, 4-Nitropyridine N-oxide-d4. Offered by: CDN, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 100 mg, 250 mg, 25 mg.
2,3,5,6-tetradeuterio-4-nitro-1-oxidopyridin-1-ium (CAS 119673-94-8) is a chemical compound with the molecular formula C5H4N2O3 and a molecular weight of 144.12 g/mol. IUPAC name: 2,3,5,6-tetradeuterio-4-nitro-1-oxidopyridin-1-ium. InChIKey: RXKNNAKAVAHBNK-RHQRLBAQSA-N.
| Molecular formula | C5H4N2O3 |
|---|---|
| Molecular weight | 144.12 g/mol |
| IUPAC name | 2,3,5,6-tetradeuterio-4-nitro-1-oxidopyridin-1-ium |
| InChIKey | RXKNNAKAVAHBNK-RHQRLBAQSA-N |
| SMILES | [2H]C1=C([N+](=C(C(=C1[N+](=O)[O-])[2H])[2H])[O-])[2H] |
Computed by PubChem (NCBI)