Products 112446-99-8
CAS 112446-99-8 is the registry number for SCH-43478. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-chloro-6-methoxy-3-methyl-2H-pyrazolo[3,4-b]quinoline (CAS 112446-99-8) is a chemical compound with the molecular formula C12H10ClN3O and a molecular weight of 247.68 g/mol. IUPAC name: 4-chloro-6-methoxy-3-methyl-2H-pyrazolo[3,4-b]quinoline. InChIKey: BQZVEXXIPVMBRN-UHFFFAOYSA-N.
| Molecular formula | C12H10ClN3O |
|---|---|
| Molecular weight | 247.68 g/mol |
| IUPAC name | 4-chloro-6-methoxy-3-methyl-2H-pyrazolo[3,4-b]quinoline |
| InChIKey | BQZVEXXIPVMBRN-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C3C=C(C=CC3=NC2=NN1)OC)Cl |
Computed by PubChem (NCBI)