CAS 446276-69-3 is the registry number for 4-Phenylphenol-13C6. Offered by: TRC. Available pack sizes: 10mg.
4-phenyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol (CAS 446276-69-3) is a chemical compound with the molecular formula C12H10O and a molecular weight of 176.16 g/mol. IUPAC name: 4-phenyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol. InChIKey: YXVFYQXJAXKLAK-UJYFPCGESA-N.
| Molecular formula | C12H10O |
|---|---|
| Molecular weight | 176.16 g/mol |
| IUPAC name | 4-phenyl(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-ol |
| InChIKey | YXVFYQXJAXKLAK-UJYFPCGESA-N |
| SMILES | C1=CC=C(C=C1)[13C]2=[13CH][13CH]=[13C]([13CH]=[13CH]2)O |
Computed by PubChem (NCBI)