Products 112641-25-5
CAS 112641-25-5 is the registry number for 2-Chloro-6-methylbenzotrifluoride, 99%. Offered by: Fluorochem. Available pack sizes: 250mg.
1-chloro-3-methyl-2-(trifluoromethyl)benzene (CAS 112641-25-5) is a chemical compound with the molecular formula C8H6ClF3 and a molecular weight of 194.58 g/mol. IUPAC name: 1-chloro-3-methyl-2-(trifluoromethyl)benzene. InChIKey: DRFZWZZCMLHZDO-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3 |
|---|---|
| Molecular weight | 194.58 g/mol |
| IUPAC name | 1-chloro-3-methyl-2-(trifluoromethyl)benzene |
| InChIKey | DRFZWZZCMLHZDO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)