CAS 1802432-25-2 is the registry number for 1-Chloro-4-(1,1-difluoroethyl)-2-fluorobenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-chloro-4-(1,1-difluoroethyl)-2-fluorobenzene (CAS 1802432-25-2) is a chemical compound with the molecular formula C8H6ClF3 and a molecular weight of 194.58 g/mol. IUPAC name: 1-chloro-4-(1,1-difluoroethyl)-2-fluorobenzene. InChIKey: TWKRDWUONDFBLL-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3 |
|---|---|
| Molecular weight | 194.58 g/mol |
| IUPAC name | 1-chloro-4-(1,1-difluoroethyl)-2-fluorobenzene |
| InChIKey | TWKRDWUONDFBLL-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)Cl)F)(F)F |
Computed by PubChem (NCBI)