CAS 384-65-6 is the registry number for (1-Chloro-2,2,2-trifluoroethyl)benzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1-chloro-2,2,2-trifluoroethyl)benzene (CAS 384-65-6) is a chemical compound with the molecular formula C8H6ClF3 and a molecular weight of 194.58 g/mol. IUPAC name: (1-chloro-2,2,2-trifluoroethyl)benzene. InChIKey: GIZBYELHYIBHIR-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3 |
|---|---|
| Molecular weight | 194.58 g/mol |
| IUPAC name | (1-chloro-2,2,2-trifluoroethyl)benzene |
| InChIKey | GIZBYELHYIBHIR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(F)(F)F)Cl |
Computed by PubChem (NCBI)