CAS 145914-05-2 is the registry number for 1-Chloro-2-(2,2,2-trifluoroethyl)benzene 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1-chloro-2-(2,2,2-trifluoroethyl)benzene (CAS 145914-05-2) is a chemical compound with the molecular formula C8H6ClF3 and a molecular weight of 194.58 g/mol. IUPAC name: 1-chloro-2-(2,2,2-trifluoroethyl)benzene. InChIKey: WGQGWJIUZVXRKN-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3 |
|---|---|
| Molecular weight | 194.58 g/mol |
| IUPAC name | 1-chloro-2-(2,2,2-trifluoroethyl)benzene |
| InChIKey | WGQGWJIUZVXRKN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(F)(F)F)Cl |
Computed by PubChem (NCBI)