CAS 74483-47-9 appears in our catalog under these names: 2-Chloro-1-methyl-4-(trifluoromethyl)benzene, 95%, 3-Chloro-4-methylbenzotrifluoride, ≥95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
2-chloro-1-methyl-4-(trifluoromethyl)benzene (CAS 74483-47-9) is a chemical compound with the molecular formula C8H6ClF3 and a molecular weight of 194.58 g/mol. IUPAC name: 2-chloro-1-methyl-4-(trifluoromethyl)benzene. InChIKey: DPBMOEZTWZVXLL-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3 |
|---|---|
| Molecular weight | 194.58 g/mol |
| IUPAC name | 2-chloro-1-methyl-4-(trifluoromethyl)benzene |
| InChIKey | DPBMOEZTWZVXLL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)