CAS 705-29-3 appears in our catalog under these names: 3-(trifluoromethyl)benzyl chloride, 3–(Trifluoromethyl)benzyl chloride, 3-(Trifluoromethyl)benzyl chloride, 97%, 3-(Trifluoromethyl)benzyl chloride, 98% , 3-(Trifluoromethyl)benzyl chloride, 98%. Offered by: TRC, GLPBio, Biosynth, Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 100mg, 1g, 500mg, 100g, 25g, 250g, 5g, 500g.
1-(chloromethyl)-3-(trifluoromethyl)benzene (CAS 705-29-3) is a chemical compound with the molecular formula C8H6ClF3 and a molecular weight of 194.58 g/mol. IUPAC name: 1-(chloromethyl)-3-(trifluoromethyl)benzene. InChIKey: XGASTRVQNVVYIZ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF3 |
|---|---|
| Molecular weight | 194.58 g/mol |
| IUPAC name | 1-(chloromethyl)-3-(trifluoromethyl)benzene |
| InChIKey | XGASTRVQNVVYIZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)CCl |
Computed by PubChem (NCBI)