Products 1127217-42-8
CAS 1127217-42-8 is the registry number for Ethyl 5-(3-chlorophenyl)thiophene-2-carboxylate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g, 25g.
Ethyl 5-(3-chlorophenyl)thiophene-2-carboxylate (CAS 1127217-42-8) is a chemical compound with the molecular formula C13H11ClO2S and a molecular weight of 266.74 g/mol. IUPAC name: ethyl 5-(3-chlorophenyl)thiophene-2-carboxylate. InChIKey: RWHLLQDNXKSYJF-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO2S |
|---|---|
| Molecular weight | 266.74 g/mol |
| IUPAC name | ethyl 5-(3-chlorophenyl)thiophene-2-carboxylate |
| InChIKey | RWHLLQDNXKSYJF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(S1)C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)