CAS 24539-54-6 is the registry number for 4-Chloro-2-methyldiphenyl sulfone, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
1-(benzenesulfonyl)-4-chloro-2-methylbenzene (CAS 24539-54-6) is a chemical compound with the molecular formula C13H11ClO2S and a molecular weight of 266.74 g/mol. IUPAC name: 1-(benzenesulfonyl)-4-chloro-2-methylbenzene. InChIKey: MYGRKFFJSSUWQY-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO2S |
|---|---|
| Molecular weight | 266.74 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-4-chloro-2-methylbenzene |
| InChIKey | MYGRKFFJSSUWQY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)S(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)