Products 89566-27-8

CAS 89566-27-8 is the registry number for [1,1′-Biphenyl]-4-ylmethanesulfonyl chloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

(4-phenylphenyl)methanesulfonyl chloride (CAS 89566-27-8) is a chemical compound with the molecular formula C13H11ClO2S and a molecular weight of 266.74 g/mol. IUPAC name: (4-phenylphenyl)methanesulfonyl chloride. InChIKey: SVNFRFPPMHIOIW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11ClO2S
Molecular weight266.74 g/mol
IUPAC name(4-phenylphenyl)methanesulfonyl chloride
InChIKeySVNFRFPPMHIOIW-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=CC=C(C=C2)CS(=O)(=O)Cl

Computed by PubChem (NCBI)