CAS 89566-27-8 is the registry number for [1,1′-Biphenyl]-4-ylmethanesulfonyl chloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(4-phenylphenyl)methanesulfonyl chloride (CAS 89566-27-8) is a chemical compound with the molecular formula C13H11ClO2S and a molecular weight of 266.74 g/mol. IUPAC name: (4-phenylphenyl)methanesulfonyl chloride. InChIKey: SVNFRFPPMHIOIW-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO2S |
|---|---|
| Molecular weight | 266.74 g/mol |
| IUPAC name | (4-phenylphenyl)methanesulfonyl chloride |
| InChIKey | SVNFRFPPMHIOIW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)CS(=O)(=O)Cl |
Computed by PubChem (NCBI)