Products 1368560-75-1

CAS 1368560-75-1 appears in our catalog under these names: 3-Methyl-5-phenylbenzene-1-sulfonyl chloride, 3-Methyl-5-phenylbenzene-1-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 5g, 1g.

3-methyl-5-phenylbenzenesulfonyl chloride (CAS 1368560-75-1) is a chemical compound with the molecular formula C13H11ClO2S and a molecular weight of 266.74 g/mol. IUPAC name: 3-methyl-5-phenylbenzenesulfonyl chloride. InChIKey: LAFXIRLTDZSVDI-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11ClO2S
Molecular weight266.74 g/mol
IUPAC name3-methyl-5-phenylbenzenesulfonyl chloride
InChIKeyLAFXIRLTDZSVDI-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1)S(=O)(=O)Cl)C2=CC=CC=C2

Computed by PubChem (NCBI)