CAS 186551-47-3 appears in our catalog under these names: 3'-Methylbiphenyl-4-sulfonyl chloride, 95%, 3'-Methyl-biphenyl-4-sulfonyl chloride, 95%, 3'-Methyl-(1,1'-biphenyl)-4-sulfonyl chloride, 97%. Offered by: Combi-blocks, Fluorochem, AmBeed. Available pack sizes: 250mg, 5g, 1g, 500mg.
4-(3-methylphenyl)benzenesulfonyl chloride (CAS 186551-47-3) is a chemical compound with the molecular formula C13H11ClO2S and a molecular weight of 266.74 g/mol. IUPAC name: 4-(3-methylphenyl)benzenesulfonyl chloride. InChIKey: OHVJVSGIYVAZFD-UHFFFAOYSA-N.
| Molecular formula | C13H11ClO2S |
|---|---|
| Molecular weight | 266.74 g/mol |
| IUPAC name | 4-(3-methylphenyl)benzenesulfonyl chloride |
| InChIKey | OHVJVSGIYVAZFD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)