Products 861226-90-6

CAS 861226-90-6 appears in our catalog under these names: 5-(4-Chlorophenyl)-4-ethylthiophene-2-carboxylic acid, 95+%, 5-(4-Chloro-phenyl)-4-ethyl-thiophene-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g.

Structural formula: {0} (CAS {1})

5-(4-chlorophenyl)-4-ethylthiophene-2-carboxylic acid (CAS 861226-90-6) is a chemical compound with the molecular formula C13H11ClO2S and a molecular weight of 266.74 g/mol. IUPAC name: 5-(4-chlorophenyl)-4-ethylthiophene-2-carboxylic acid. InChIKey: LMPWZOKTUAGCHE-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11ClO2S
Molecular weight266.74 g/mol
IUPAC name5-(4-chlorophenyl)-4-ethylthiophene-2-carboxylic acid
InChIKeyLMPWZOKTUAGCHE-UHFFFAOYSA-N
SMILESCCC1=C(SC(=C1)C(=O)O)C2=CC=C(C=C2)Cl

Computed by PubChem (NCBI)