CAS 116668-56-5 is the registry number for (S)-3-Phenyldihydrofuran-2,5-dione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.
(3S)-3-phenyloxolane-2,5-dione (CAS 116668-56-5) is a chemical compound with the molecular formula C10H8O3 and a molecular weight of 176.17 g/mol. IUPAC name: (3S)-3-phenyloxolane-2,5-dione. InChIKey: HDFKMLFDDYWABF-QMMMGPOBSA-N.
| Molecular formula | C10H8O3 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | (3S)-3-phenyloxolane-2,5-dione |
| InChIKey | HDFKMLFDDYWABF-QMMMGPOBSA-N |
| SMILES | C1[C@H](C(=O)OC1=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)