CAS 113100-53-1 appears in our catalog under these names: 3-(Trifluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic Acid, >95% (HPLC), 3–(Trifluoromethyl)–1–methyl–1H–pyrazole–4–carboxylic acid, 1-Methyl-3-(trifluoromethyl)pyrazole-4-carboxylic Acid, >98.0%(GC)(T), 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid, 97% , 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid 98%. Offered by: TRC, GLPBio, TCI, Thermo Scientific, Ambeed. Available pack sizes: 10g, 2,5g, 25g, 100g, 1g, 250MG, 500g, 5g.
1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid (CAS 113100-53-1) is a chemical compound with the molecular formula C6H5F3N2O2 and a molecular weight of 194.11 g/mol. IUPAC name: 1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid. InChIKey: FZNKJQNEJGXCJH-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2O2 |
|---|---|
| Molecular weight | 194.11 g/mol |
| IUPAC name | 1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid |
| InChIKey | FZNKJQNEJGXCJH-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)