Products 113136-79-1
CAS 113136-79-1 is the registry number for Cabozantinib Impurity 47. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
1-[(4-chlorophenyl)carbamoyl]cyclopropane-1-carboxylic acid (CAS 113136-79-1) is a chemical compound with the molecular formula C11H10ClNO3 and a molecular weight of 239.65 g/mol. IUPAC name: 1-[(4-chlorophenyl)carbamoyl]cyclopropane-1-carboxylic acid. InChIKey: MLZWLPGHVWZLJO-UHFFFAOYSA-N.
| Molecular formula | C11H10ClNO3 |
|---|---|
| Molecular weight | 239.65 g/mol |
| IUPAC name | 1-[(4-chlorophenyl)carbamoyl]cyclopropane-1-carboxylic acid |
| InChIKey | MLZWLPGHVWZLJO-UHFFFAOYSA-N |
| SMILES | C1CC1(C(=O)NC2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Cabozantinib Impurity 76, 1-((4-chlorophenyl)carbamoyl)cyclopropane-1-carboxylic acid, 1-[(4-chlorophenyl)carbamoyl]cyclopropane-1-carboxylic acid, 1-((4-chlorophenyl)carbamoyl)cyclopropanecarboxylic acid, Cabozantinib Impurity N2, 1-[[(4-Chlorophenyl)amino]carbonyl]cyclopropanecarboxylic acid, Cyclopropanecarboxylic acid, 1-[[(4-chlorophenyl)amino]carbonyl]-