CAS 1132-05-4 appears in our catalog under these names: 3′–Allyl–4′–hydroxyacetophenone, 3'-Allyl-4'-hydroxyacetophenone, 95%, 3'-ALLYL-4'-HYDROXYACETOPHENONE, 97%, 3'-Allyl-4'-hydroxyacetophenone, ≥97%, 1-(3-Allyl-4-hydroxyphenyl)ethanone, 97%, 97%. Offered by: GLPBio, Combi-blocks, Sigma-Aldrich, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 25g.
1-(4-hydroxy-3-prop-2-enylphenyl)ethanone (CAS 1132-05-4) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 1-(4-hydroxy-3-prop-2-enylphenyl)ethanone. InChIKey: XVTCWUFLNLZPEJ-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 1-(4-hydroxy-3-prop-2-enylphenyl)ethanone |
| InChIKey | XVTCWUFLNLZPEJ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)O)CC=C |
Computed by PubChem (NCBI)