CAS 1196981-04-0 appears in our catalog under these names: 1-(4-Bromo-1H-indol-1-yl)-2,2-dimethylpropan-1-one, 98%, N-pivaloyl-4-bromoindole, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 25g, 1g, 100g, 5g, 10g.
1-(4-bromoindol-1-yl)-2,2-dimethylpropan-1-one (CAS 1196981-04-0) is a chemical compound with the molecular formula C13H14BrNO and a molecular weight of 280.16 g/mol. IUPAC name: 1-(4-bromoindol-1-yl)-2,2-dimethylpropan-1-one. InChIKey: TUCSLJFSOTXKRX-UHFFFAOYSA-N.
| Molecular formula | C13H14BrNO |
|---|---|
| Molecular weight | 280.16 g/mol |
| IUPAC name | 1-(4-bromoindol-1-yl)-2,2-dimethylpropan-1-one |
| InChIKey | TUCSLJFSOTXKRX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)N1C=CC2=C1C=CC=C2Br |
Computed by PubChem (NCBI)