CAS 113269-46-8 is the registry number for Oxetanocin G. Offered by: TRC. Available pack sizes: 100mg.
2-amino-9-[(2R,3R,4S)-3,4-bis(hydroxymethyl)oxetan-2-yl]-1H-purin-6-one (CAS 113269-46-8) is a chemical compound with the molecular formula C10H13N5O4 and a molecular weight of 267.24 g/mol. IUPAC name: 2-amino-9-[(2R,3R,4S)-3,4-bis(hydroxymethyl)oxetan-2-yl]-1H-purin-6-one. InChIKey: BCSLVBZWCFTDPK-UDJQAZALSA-N.
| Molecular formula | C10H13N5O4 |
|---|---|
| Molecular weight | 267.24 g/mol |
| IUPAC name | 2-amino-9-[(2R,3R,4S)-3,4-bis(hydroxymethyl)oxetan-2-yl]-1H-purin-6-one |
| InChIKey | BCSLVBZWCFTDPK-UDJQAZALSA-N |
| SMILES | C1=NC2=C(N1[C@H]3[C@@H]([C@H](O3)CO)CO)N=C(NC2=O)N |
Computed by PubChem (NCBI)