Products 1618647-91-8
CAS 1618647-91-8 is the registry number for tert-Butyl (4-bromo-2,6-dimethylbenzyl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[(4-bromo-2,6-dimethylphenyl)methyl]carbamate (CAS 1618647-91-8) is a chemical compound with the molecular formula C14H20BrNO2 and a molecular weight of 314.22 g/mol. IUPAC name: tert-butyl N-[(4-bromo-2,6-dimethylphenyl)methyl]carbamate. InChIKey: GLGFDRFQXMSQCJ-UHFFFAOYSA-N.
| Molecular formula | C14H20BrNO2 |
|---|---|
| Molecular weight | 314.22 g/mol |
| IUPAC name | tert-butyl N-[(4-bromo-2,6-dimethylphenyl)methyl]carbamate |
| InChIKey | GLGFDRFQXMSQCJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1CNC(=O)OC(C)(C)C)C)Br |
Computed by PubChem (NCBI)