CAS 1138-62-1 is the registry number for 4-MethoxyphenylN,N-dimethylsulfamate, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
(4-methoxyphenyl) N,N-dimethylsulfamate (CAS 1138-62-1) is a chemical compound with the molecular formula C9H13NO4S and a molecular weight of 231.27 g/mol. IUPAC name: (4-methoxyphenyl) N,N-dimethylsulfamate. InChIKey: VYCOGTHNDCLQSG-UHFFFAOYSA-N.
| Molecular formula | C9H13NO4S |
|---|---|
| Molecular weight | 231.27 g/mol |
| IUPAC name | (4-methoxyphenyl) N,N-dimethylsulfamate |
| InChIKey | VYCOGTHNDCLQSG-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)OC1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)