CAS 2377184-21-7 is the registry number for 2-((1R,4S)-3-Oxo-2-azabicyclo[2.2.1]hept-5-en-2-yl)ethyl methanesulfonate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(1R,4S)-3-oxo-2-azabicyclo[2.2.1]hept-5-en-2-yl]ethyl methanesulfonate (CAS 2377184-21-7) is a chemical compound with the molecular formula C9H13NO4S and a molecular weight of 231.27 g/mol. IUPAC name: 2-[(1R,4S)-3-oxo-2-azabicyclo[2.2.1]hept-5-en-2-yl]ethyl methanesulfonate. InChIKey: HOZROUHLKDKNSR-SFYZADRCSA-N.
| Molecular formula | C9H13NO4S |
|---|---|
| Molecular weight | 231.27 g/mol |
| IUPAC name | 2-[(1R,4S)-3-oxo-2-azabicyclo[2.2.1]hept-5-en-2-yl]ethyl methanesulfonate |
| InChIKey | HOZROUHLKDKNSR-SFYZADRCSA-N |
| SMILES | CS(=O)(=O)OCCN1[C@@H]2C[C@H](C1=O)C=C2 |
Computed by PubChem (NCBI)