Products 1249235-67-3

CAS 1249235-67-3 is the registry number for 2-(1-Oxidothiomorpholine-4-carbonyl)cyclopropane-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(1-oxo-1,4-thiazinane-4-carbonyl)cyclopropane-1-carboxylic acid (CAS 1249235-67-3) is a chemical compound with the molecular formula C9H13NO4S and a molecular weight of 231.27 g/mol. IUPAC name: 2-(1-oxo-1,4-thiazinane-4-carbonyl)cyclopropane-1-carboxylic acid. InChIKey: ONEKFVXFBQZBBI-UHFFFAOYSA-N.

Identity
Molecular formulaC9H13NO4S
Molecular weight231.27 g/mol
IUPAC name2-(1-oxo-1,4-thiazinane-4-carbonyl)cyclopropane-1-carboxylic acid
InChIKeyONEKFVXFBQZBBI-UHFFFAOYSA-N
SMILESC1CS(=O)CCN1C(=O)C2CC2C(=O)O

Computed by PubChem (NCBI)