Products 13614-18-1

CAS 13614-18-1 is the registry number for Rel-(1R,2S)-2-phenylcyclopropan-1-amine xsulfate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Sulfuric acid;trans-(1R,2S)-2-phenylcyclopropan-1-amine (CAS 13614-18-1) is a chemical compound with the molecular formula C9H13NO4S and a molecular weight of 231.27 g/mol. IUPAC name: sulfuric acid;trans-(1R,2S)-2-phenylcyclopropan-1-amine. InChIKey: BTHVHSMCHJCPFU-OULXEKPRSA-N.

Identity
Molecular formulaC9H13NO4S
Molecular weight231.27 g/mol
IUPAC namesulfuric acid;trans-(1R,2S)-2-phenylcyclopropan-1-amine
InChIKeyBTHVHSMCHJCPFU-OULXEKPRSA-N
SMILESC1[C@H]([C@@H]1N)C2=CC=CC=C2.OS(=O)(=O)O

Computed by PubChem (NCBI)