CAS 13614-18-1 is the registry number for Rel-(1R,2S)-2-phenylcyclopropan-1-amine xsulfate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Sulfuric acid;trans-(1R,2S)-2-phenylcyclopropan-1-amine (CAS 13614-18-1) is a chemical compound with the molecular formula C9H13NO4S and a molecular weight of 231.27 g/mol. IUPAC name: sulfuric acid;trans-(1R,2S)-2-phenylcyclopropan-1-amine. InChIKey: BTHVHSMCHJCPFU-OULXEKPRSA-N.
| Molecular formula | C9H13NO4S |
|---|---|
| Molecular weight | 231.27 g/mol |
| IUPAC name | sulfuric acid;trans-(1R,2S)-2-phenylcyclopropan-1-amine |
| InChIKey | BTHVHSMCHJCPFU-OULXEKPRSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=CC=CC=C2.OS(=O)(=O)O |
Computed by PubChem (NCBI)