CAS 287944-27-8 is the registry number for Metoprolol Impurity 33. Offered by: Chemat Brand. Available pack sizes: on request.
N-[4-[(1S)-1,2-dihydroxyethyl]phenyl]methanesulfonamide (CAS 287944-27-8) is a chemical compound with the molecular formula C9H13NO4S and a molecular weight of 231.27 g/mol. IUPAC name: N-[4-[(1S)-1,2-dihydroxyethyl]phenyl]methanesulfonamide. InChIKey: DBAVYQMWAVSFBA-SECBINFHSA-N.
| Molecular formula | C9H13NO4S |
|---|---|
| Molecular weight | 231.27 g/mol |
| IUPAC name | N-[4-[(1S)-1,2-dihydroxyethyl]phenyl]methanesulfonamide |
| InChIKey | DBAVYQMWAVSFBA-SECBINFHSA-N |
| SMILES | CS(=O)(=O)NC1=CC=C(C=C1)[C@@H](CO)O |
Computed by PubChem (NCBI)