CAS 1342430-62-9 is the registry number for 3-(Prop-2-yn-1-ylamino)tetrahydro-2H-thiopyran-3-carboxylic acid 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1,1-dioxo-3-(prop-2-ynylamino)thiane-3-carboxylic acid (CAS 1342430-62-9) is a chemical compound with the molecular formula C9H13NO4S and a molecular weight of 231.27 g/mol. IUPAC name: 1,1-dioxo-3-(prop-2-ynylamino)thiane-3-carboxylic acid. InChIKey: CDABYROLSQVQMI-UHFFFAOYSA-N.
| Molecular formula | C9H13NO4S |
|---|---|
| Molecular weight | 231.27 g/mol |
| IUPAC name | 1,1-dioxo-3-(prop-2-ynylamino)thiane-3-carboxylic acid |
| InChIKey | CDABYROLSQVQMI-UHFFFAOYSA-N |
| SMILES | C#CCNC1(CCCS(=O)(=O)C1)C(=O)O |
Computed by PubChem (NCBI)