Products 113882-33-0
CAS 113882-33-0 appears in our catalog under these names: 3-Methyl-5-nitrobenzoic acid 95%, 3-Methyl-5-nitrobenzoic acid, 95%, 95%, 3-Methyl-5-nitrobenzoic acid, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 25g, 100g.
3-methyl-5-nitrobenzoic acid (CAS 113882-33-0) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 3-methyl-5-nitrobenzoic acid. InChIKey: XAPRFOJQNGFJSZ-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 3-methyl-5-nitrobenzoic acid |
| InChIKey | XAPRFOJQNGFJSZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)