Products 113951-05-6
CAS 113951-05-6 is the registry number for Dextromethorphan Impurity 18. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,9S,10S)-4-methoxy-17-methyl-17-oxido-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene (CAS 113951-05-6) is a chemical compound with the molecular formula C18H25NO2 and a molecular weight of 287.4 g/mol. IUPAC name: (1S,9S,10S)-4-methoxy-17-methyl-17-oxido-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene. InChIKey: ZIZQARJISFQDMO-BIMIXXMJSA-N.
| Molecular formula | C18H25NO2 |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | (1S,9S,10S)-4-methoxy-17-methyl-17-oxido-17-azoniatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-triene |
| InChIKey | ZIZQARJISFQDMO-BIMIXXMJSA-N |
| SMILES | C[N+]1(CC[C@@]23CCCC[C@@H]2[C@@H]1CC4=C3C=C(C=C4)OC)[O-] |
Computed by PubChem (NCBI)