Products 849630-33-7
CAS 849630-33-7 appears in our catalog under these names: Etodolac Impurity 20, 1-Ethyl-1,3,4,9-tetrahydro-8-(1-methylethyl)pyrano(3,4-b)indole-1-ethanol. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
2-(1-ethyl-8-propan-2-yl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)ethanol (CAS 849630-33-7) is a chemical compound with the molecular formula C18H25NO2 and a molecular weight of 287.4 g/mol. IUPAC name: 2-(1-ethyl-8-propan-2-yl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)ethanol. InChIKey: LTNAADONPADCRE-UHFFFAOYSA-N.
| Molecular formula | C18H25NO2 |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | 2-(1-ethyl-8-propan-2-yl-4,9-dihydro-3H-pyrano[3,4-b]indol-1-yl)ethanol |
| InChIKey | LTNAADONPADCRE-UHFFFAOYSA-N |
| SMILES | CCC1(C2=C(CCO1)C3=C(N2)C(=CC=C3)C(C)C)CCO |
Computed by PubChem (NCBI)