Products 88607-15-2

CAS 88607-15-2 is the registry number for Atropine Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[(1R,5S)-8-propan-2-yl-8-azabicyclo[3.2.1]octan-3-yl] 2-phenylacetate (CAS 88607-15-2) is a chemical compound with the molecular formula C18H25NO2 and a molecular weight of 287.4 g/mol. IUPAC name: [(1R,5S)-8-propan-2-yl-8-azabicyclo[3.2.1]octan-3-yl] 2-phenylacetate. InChIKey: IMOZNOXAPBWYQF-SJPCQFCGSA-N.

Identity
Molecular formulaC18H25NO2
Molecular weight287.4 g/mol
IUPAC name[(1R,5S)-8-propan-2-yl-8-azabicyclo[3.2.1]octan-3-yl] 2-phenylacetate
InChIKeyIMOZNOXAPBWYQF-SJPCQFCGSA-N
SMILESCC(C)N1[C@@H]2CC[C@H]1CC(C2)OC(=O)CC3=CC=CC=C3

Computed by PubChem (NCBI)