CAS 88607-15-2 is the registry number for Atropine Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.
[(1R,5S)-8-propan-2-yl-8-azabicyclo[3.2.1]octan-3-yl] 2-phenylacetate (CAS 88607-15-2) is a chemical compound with the molecular formula C18H25NO2 and a molecular weight of 287.4 g/mol. IUPAC name: [(1R,5S)-8-propan-2-yl-8-azabicyclo[3.2.1]octan-3-yl] 2-phenylacetate. InChIKey: IMOZNOXAPBWYQF-SJPCQFCGSA-N.
| Molecular formula | C18H25NO2 |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | [(1R,5S)-8-propan-2-yl-8-azabicyclo[3.2.1]octan-3-yl] 2-phenylacetate |
| InChIKey | IMOZNOXAPBWYQF-SJPCQFCGSA-N |
| SMILES | CC(C)N1[C@@H]2CC[C@H]1CC(C2)OC(=O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)