CAS 931587-86-9 is the registry number for [2-(1-Adamantyl)-4,5-dimethoxyphenyl]amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(1-adamantyl)-4,5-dimethoxyaniline (CAS 931587-86-9) is a chemical compound with the molecular formula C18H25NO2 and a molecular weight of 287.4 g/mol. IUPAC name: 2-(1-adamantyl)-4,5-dimethoxyaniline. InChIKey: RNLQWLWZWFAALP-UHFFFAOYSA-N.
| Molecular formula | C18H25NO2 |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | 2-(1-adamantyl)-4,5-dimethoxyaniline |
| InChIKey | RNLQWLWZWFAALP-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C23CC4CC(C2)CC(C4)C3)N)OC |
Computed by PubChem (NCBI)