Products 2437328-02-2
CAS 2437328-02-2 is the registry number for Ethyl (2S,3R)-3-allyl-1-((S)-1-phenylethyl)pyrrolidine-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (2S,3R)-1-[(1S)-1-phenylethyl]-3-prop-2-enylpyrrolidine-2-carboxylate (CAS 2437328-02-2) is a chemical compound with the molecular formula C18H25NO2 and a molecular weight of 287.4 g/mol. IUPAC name: ethyl (2S,3R)-1-[(1S)-1-phenylethyl]-3-prop-2-enylpyrrolidine-2-carboxylate. InChIKey: SBHLAJVQBRCUOA-UAGQMJEPSA-N.
| Molecular formula | C18H25NO2 |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | ethyl (2S,3R)-1-[(1S)-1-phenylethyl]-3-prop-2-enylpyrrolidine-2-carboxylate |
| InChIKey | SBHLAJVQBRCUOA-UAGQMJEPSA-N |
| SMILES | CCOC(=O)[C@@H]1[C@@H](CCN1[C@@H](C)C2=CC=CC=C2)CC=C |
Computed by PubChem (NCBI)