Products 120442-81-1
CAS 120442-81-1 is the registry number for Dextromethorphan Impurity 21. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,8R,9R,10S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-8-ol (CAS 120442-81-1) is a chemical compound with the molecular formula C18H25NO2 and a molecular weight of 287.4 g/mol. IUPAC name: (1S,8R,9R,10S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-8-ol. InChIKey: VHADEHXKPTVSKZ-DDBAPUKQSA-N.
| Molecular formula | C18H25NO2 |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | (1S,8R,9R,10S)-4-methoxy-17-methyl-17-azatetracyclo[7.5.3.01,10.02,7]heptadeca-2(7),3,5-trien-8-ol |
| InChIKey | VHADEHXKPTVSKZ-DDBAPUKQSA-N |
| SMILES | CN1CC[C@@]23CCCC[C@@H]2[C@@H]1[C@@H](C4=C3C=C(C=C4)OC)O |
Computed by PubChem (NCBI)