Products 1141015-47-5
CAS 1141015-47-5 is the registry number for 4-Chloro-5-(trifluoromethyl)thiophene-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-5-(trifluoromethyl)thiophene-2-carboxylic acid (CAS 1141015-47-5) is a chemical compound with the molecular formula C6H2ClF3O2S and a molecular weight of 230.59 g/mol. IUPAC name: 4-chloro-5-(trifluoromethyl)thiophene-2-carboxylic acid. InChIKey: AYJCDSFOEZDCJJ-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF3O2S |
|---|---|
| Molecular weight | 230.59 g/mol |
| IUPAC name | 4-chloro-5-(trifluoromethyl)thiophene-2-carboxylic acid |
| InChIKey | AYJCDSFOEZDCJJ-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1Cl)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)