CAS 351003-43-5 appears in our catalog under these names: 3,4,5–Trifluorobenzenesulfonyl chloride, 3,4,5-Trifluorobenzenesulfonyl chloride, 96%. Offered by: GLPBio, Fluorochem. Available pack sizes: 100g, 25g, 5g.
3,4,5-trifluorobenzenesulfonyl chloride (CAS 351003-43-5) is a chemical compound with the molecular formula C6H2ClF3O2S and a molecular weight of 230.59 g/mol. IUPAC name: 3,4,5-trifluorobenzenesulfonyl chloride. InChIKey: HSEHKULCGSMHAE-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF3O2S |
|---|---|
| Molecular weight | 230.59 g/mol |
| IUPAC name | 3,4,5-trifluorobenzenesulfonyl chloride |
| InChIKey | HSEHKULCGSMHAE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)