Products 2172039-11-9
CAS 2172039-11-9 is the registry number for 4-Chloro-3,5-difluorobenzenesulfonyl fluoride, 95%. Offered by: Ambeed, BLDpharm. Available pack sizes: 250mg, 1g, 5g, 25g.
4-chloro-3,5-difluorobenzenesulfonyl fluoride (CAS 2172039-11-9) is a chemical compound with the molecular formula C6H2ClF3O2S and a molecular weight of 230.59 g/mol. IUPAC name: 4-chloro-3,5-difluorobenzenesulfonyl fluoride. InChIKey: LAKYKJJMXAZQTA-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF3O2S |
|---|---|
| Molecular weight | 230.59 g/mol |
| IUPAC name | 4-chloro-3,5-difluorobenzenesulfonyl fluoride |
| InChIKey | LAKYKJJMXAZQTA-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1F)Cl)F)S(=O)(=O)F |
Computed by PubChem (NCBI)