CAS 175278-08-7 appears in our catalog under these names: 2,3,4–Trifluorobenzenesulfonyl chloride, 2,3,4-Trifluorobenzene-1-sulfonyl chloride, 97% , 2,3,4-Trifluorobenzenesulfonyl chloride, 95%. Offered by: GLPBio, Thermo Scientific, Fluorochem. Available pack sizes: 5g, 1g, 10g, 25g, 100g.
2,3,4-trifluorobenzenesulfonyl chloride (CAS 175278-08-7) is a chemical compound with the molecular formula C6H2ClF3O2S and a molecular weight of 230.59 g/mol. IUPAC name: 2,3,4-trifluorobenzenesulfonyl chloride. InChIKey: XFTDZYFHXRZLEF-UHFFFAOYSA-N.
| Molecular formula | C6H2ClF3O2S |
|---|---|
| Molecular weight | 230.59 g/mol |
| IUPAC name | 2,3,4-trifluorobenzenesulfonyl chloride |
| InChIKey | XFTDZYFHXRZLEF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)F)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)