CAS 1142198-13-7 is the registry number for 1-(3-Methoxyphenyl)-6,6-dimethylpiperazine-2,3-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(3-methoxyphenyl)-6,6-dimethylpiperazine-2,3-dione (CAS 1142198-13-7) is a chemical compound with the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. IUPAC name: 1-(3-methoxyphenyl)-6,6-dimethylpiperazine-2,3-dione. InChIKey: TURLGPUHODKRIC-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O3 |
|---|---|
| Molecular weight | 248.28 g/mol |
| IUPAC name | 1-(3-methoxyphenyl)-6,6-dimethylpiperazine-2,3-dione |
| InChIKey | TURLGPUHODKRIC-UHFFFAOYSA-N |
| SMILES | CC1(CNC(=O)C(=O)N1C2=CC(=CC=C2)OC)C |
Computed by PubChem (NCBI)