CAS 1142214-24-1 is the registry number for 2-(Chloroacetyl)-8-methyl-2,3,4,5-tetrahydro-1h-pyrido[4,3-b]indole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-chloro-1-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone (CAS 1142214-24-1) is a chemical compound with the molecular formula C14H15ClN2O and a molecular weight of 262.73 g/mol. IUPAC name: 2-chloro-1-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone. InChIKey: AYMOQCHEQIBRIR-UHFFFAOYSA-N.
| Molecular formula | C14H15ClN2O |
|---|---|
| Molecular weight | 262.73 g/mol |
| IUPAC name | 2-chloro-1-(8-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)ethanone |
| InChIKey | AYMOQCHEQIBRIR-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC3=C2CN(CC3)C(=O)CCl |
Computed by PubChem (NCBI)