CAS 937608-65-6 is the registry number for N-[3-(4-Amino-2-chlorophenoxy)phenyl]-N,N-dimethylamine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-chloro-4-[3-(dimethylamino)phenoxy]aniline (CAS 937608-65-6) is a chemical compound with the molecular formula C14H15ClN2O and a molecular weight of 262.73 g/mol. IUPAC name: 3-chloro-4-[3-(dimethylamino)phenoxy]aniline. InChIKey: ZSQWTJGGLDEJKR-UHFFFAOYSA-N.
| Molecular formula | C14H15ClN2O |
|---|---|
| Molecular weight | 262.73 g/mol |
| IUPAC name | 3-chloro-4-[3-(dimethylamino)phenoxy]aniline |
| InChIKey | ZSQWTJGGLDEJKR-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC(=CC=C1)OC2=C(C=C(C=C2)N)Cl |
Computed by PubChem (NCBI)