CAS 132139-28-7 appears in our catalog under these names: 2-Amino-n,n-diphenylacetamide hydrochloride, 95%, 2-Amino-N,N-diphenylacetamide hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 2,5g.
2-amino-N,N-diphenylacetamide;hydrochloride (CAS 132139-28-7) is a chemical compound with the molecular formula C14H15ClN2O and a molecular weight of 262.73 g/mol. IUPAC name: 2-amino-N,N-diphenylacetamide;hydrochloride. InChIKey: VSUGKINFLWVRGB-UHFFFAOYSA-N.
| Molecular formula | C14H15ClN2O |
|---|---|
| Molecular weight | 262.73 g/mol |
| IUPAC name | 2-amino-N,N-diphenylacetamide;hydrochloride |
| InChIKey | VSUGKINFLWVRGB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N(C2=CC=CC=C2)C(=O)CN.Cl |
Computed by PubChem (NCBI)