CAS 57928-60-6 appears in our catalog under these names: 4-(Benzyloxy)benzene-1-carboximidamide hydrochloride, 95%, 4-(Benzyloxy)benzimidamide hydrochloride 95+%, 4-(Benzyloxy)benzimidamide hydrochloride, 95+%, 95+%. Offered by: Combi-blocks, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 10g, 100mg.
4-phenylmethoxybenzenecarboximidamide;hydrochloride (CAS 57928-60-6) is a chemical compound with the molecular formula C14H15ClN2O and a molecular weight of 262.73 g/mol. IUPAC name: 4-phenylmethoxybenzenecarboximidamide;hydrochloride. InChIKey: YYXKRNUJMKSJMF-UHFFFAOYSA-N.
| Molecular formula | C14H15ClN2O |
|---|---|
| Molecular weight | 262.73 g/mol |
| IUPAC name | 4-phenylmethoxybenzenecarboximidamide;hydrochloride |
| InChIKey | YYXKRNUJMKSJMF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C(=N)N.Cl |
Computed by PubChem (NCBI)